Online Database of Chemicals from Around the World

Dimethyl 3-aminophthalate hydrochloride
[CAS 52412-63-2]

List of Suppliers
Xi'an Tuochao Biotechnology Co., Ltd. China
www.xatuochao.cn
+86 18092957403
chen.zeshan@xatuochao.com
QQ Chat
Skype Chat
WeChat: +8618092957403
WhatsApp:+8618092957403
Chemical manufacturer since 2017
chemBlink Standard supplier since 2023

Identification
ClassificationOrganic raw materials >> Carboxylic compounds and derivatives >> Salt of carboxylic acid ester and its derivatives
NameDimethyl 3-aminophthalate hydrochloride
Molecular StructureDimethyl 3-aminophthalate hydrochloride molecular structure (CAS 52412-63-2)
Molecular FormulaC10H12ClNO4
Molecular Weight245.66
CAS Registry Number52412-63-2
SMILESCOC(=O)C1=C(C(=CC=C1)N)C(=O)OC.Cl
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH302-H315-H319-H335  Details
Safety StatementsP261-P305+P351+P338  Details
SDSAvailable
up chemBlink Chemical Story
Dimethyl 3-aminophthalate hydrochloride is a chemical compound that has attracted attention in various fields, particularly in organic synthesis and medicinal chemistry. It is a derivative of phthalic acid and features both amine and ester functional groups, which provide unique reactivity and versatility in chemical reactions. The synthesis of dimethyl 3-aminophthalate hydrochloride typically involves the introduction of an amino group onto the phthalate structure, followed by methylation to produce the dimethyl ester. This compound is often synthesized through a multi-step process that includes the use of protective groups to ensure selective functionalization of the target site.

The discovery of dimethyl 3-aminophthalate hydrochloride can be linked to the broader investigation of phthalate derivatives, which have been studied for their diverse chemical properties and potential applications. The introduction of amino groups into phthalate esters enhances their reactivity and makes them suitable intermediates for further transformations. This compound has shown promise in the synthesis of various biologically active molecules, making it valuable in medicinal chemistry.

One of the primary applications of dimethyl 3-aminophthalate hydrochloride is in the development of pharmaceuticals. The amino group present in the compound serves as a site for nucleophilic substitution reactions, enabling the construction of complex drug-like structures. These transformations can lead to the creation of compounds with specific biological activities, including anti-inflammatory, antimicrobial, and anticancer properties. As a result, dimethyl 3-aminophthalate hydrochloride is often utilized in the design and synthesis of novel therapeutic agents.

In addition to its role in pharmaceutical development, dimethyl 3-aminophthalate hydrochloride has applications in materials science. The compound can act as a building block in the synthesis of functionalized polymers and materials with tailored properties. The presence of the amino group allows for further chemical modifications, enabling the development of advanced materials that exhibit enhanced performance in areas such as coatings, adhesives, and electronic devices. The ability to modify the physical and chemical properties of materials through the incorporation of dimethyl 3-aminophthalate hydrochloride contributes to its utility in various industrial applications.

Moreover, the compound's hydrochloride form enhances its solubility and stability, making it easier to handle and integrate into various chemical processes. This characteristic is particularly beneficial in laboratory settings where precise measurements and reactions are crucial. The solubility of dimethyl 3-aminophthalate hydrochloride in aqueous and organic solvents facilitates its use in a wide range of synthetic protocols.

In conclusion, dimethyl 3-aminophthalate hydrochloride is a versatile compound with significant applications in medicinal chemistry and materials science. Its unique structural features, including the amino and ester functional groups, enable it to serve as an important building block for the synthesis of biologically active compounds and functionalized materials. The ongoing research and development surrounding this compound will likely lead to further innovations in drug design and materials technology.
Market Analysis Reports
Related Products
1-(4-{2-[4-(Dim...  3-(4-{(E)-2-[4-...  10alpha-[2-[4-(...  2-[2-[4-(Dimeth...  2-[2-[4-(Dimeth...  2-[2-[4-(Dimeth...  (1-Dimethylamin...  N,N-Dimethylami...  Dimethyl 3-amin...  Dimethyl 4-Amin...  2-(Dimethylamin...  N-Boc-4-Dimethy...  3-Dimethylamino...  4-(Dimethylamin...  4-(Dimethylamin...  N-[4-[[4-(Dimet...  1-(4-Dimethylam...  (20S)-20-(Dimet...  N-(3-S(S)-(Dime...  (3b,20S)-20-(Di...